About 3-methyldecanenitrile
3-methyldecanenitrile (PubChem CID 3020614) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is 3-methyldecanenitrile.
Molecular Properties
| Compound Name | 3-methyldecanenitrile |
| PubChem CID | 3020614 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 3-methyldecanenitrile |
| SMILES | CCCCCCCC(C)CC#N |
| InChI | InChI=1S/C11H21N/c1-3-4-5-6-7-8-11(2)9-10-12/h11H,3-9H2,1-2H3 |
| InChIKey | MIKYASNSDCJESJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methyldecanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyldecanenitrile?
The IUPAC name of 3-methyldecanenitrile (CID 3020614) is 3-methyldecanenitrile.
What is the SMILES notation for 3-methyldecanenitrile?
The canonical SMILES for 3-methyldecanenitrile is CCCCCCCC(C)CC#N.
What is the InChIKey of 3-methyldecanenitrile?
The InChIKey is MIKYASNSDCJESJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N/c1-3-4-5-6-7-8-11(2)9-10-12/h11H,3-9H2,1-2H3.
What are the key properties of 3-methyldecanenitrile?
3-methyldecanenitrile has a molecular weight of 167.30 g/mol, XLogP of 3.90, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyldecanenitrile is sourced from PubChem (CID 3020614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).