C13H29N3O — CID 3020657
2-[2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethylamino]ethanol (PubChem CID 3020657) has the molecular formula C13H29N3O and a molecular weight of 243.39 g/mol. Its IUPAC name is 2-[2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethylamino]ethanol.
| Compound Name | 2-[2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethylamino]ethanol |
|---|---|
| PubChem CID | 3020657 |
| Molecular Formula | C13H29N3O |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.23 |
| IUPAC Name | 2-[2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethylamino]ethanol |
| SMILES | CC1(C)CC(NCCNCCO)CC(C)(C)N1 |
| InChI | InChI=1S/C13H29N3O/c1-12(2)9-11(10-13(3,4)16-12)15-6-5-14-7-8-17/h11,14-17H,5-10H2,1-4H3 |
| InChIKey | TVEPUPWHYJREDJ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|