About thiophen-2-ylmethyl benzoate
thiophen-2-ylmethyl benzoate (PubChem CID 3020751) has the molecular formula C12H10O2S
and a molecular weight of 218.28 g/mol. Its IUPAC name is thiophen-2-ylmethyl benzoate.
Molecular Properties
| Compound Name | thiophen-2-ylmethyl benzoate |
| PubChem CID | 3020751 |
| Molecular Formula | C12H10O2S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | thiophen-2-ylmethyl benzoate |
| SMILES | O=C(OCc1cccs1)c1ccccc1 |
| InChI | InChI=1S/C12H10O2S/c13-12(10-5-2-1-3-6-10)14-9-11-7-4-8-15-11/h1-8H,9H2 |
| InChIKey | QFKZQXHPVSHDMJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze thiophen-2-ylmethyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophen-2-ylmethyl benzoate?
The IUPAC name of thiophen-2-ylmethyl benzoate (CID 3020751) is thiophen-2-ylmethyl benzoate.
What is the SMILES notation for thiophen-2-ylmethyl benzoate?
The canonical SMILES for thiophen-2-ylmethyl benzoate is O=C(OCc1cccs1)c1ccccc1.
What is the InChIKey of thiophen-2-ylmethyl benzoate?
The InChIKey is QFKZQXHPVSHDMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2S/c13-12(10-5-2-1-3-6-10)14-9-11-7-4-8-15-11/h1-8H,9H2.
What are the key properties of thiophen-2-ylmethyl benzoate?
thiophen-2-ylmethyl benzoate has a molecular weight of 218.28 g/mol, XLogP of 3.11, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thiophen-2-ylmethyl benzoate is sourced from PubChem (CID 3020751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).