C18H26O2 — CID 3020817
4,6-dicyclohexylbenzene-1,3-diol (PubChem CID 3020817) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 4,6-dicyclohexylbenzene-1,3-diol.
| Compound Name | 4,6-dicyclohexylbenzene-1,3-diol |
|---|---|
| PubChem CID | 3020817 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 4,6-dicyclohexylbenzene-1,3-diol |
| SMILES | Oc1cc(O)c(C2CCCCC2)cc1C1CCCCC1 |
| InChI | InChI=1S/C18H26O2/c19-17-12-18(20)16(14-9-5-2-6-10-14)11-15(17)13-7-3-1-4-8-13/h11-14,19-20H,1-10H2 |
| InChIKey | GYERJOGJSQRWET-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |