C6H2F12 — CID 3020925
1,1,1,2,3,4,5,5,5-nonafluoro-2-(trifluoromethyl)pentane (PubChem CID 3020925) has the molecular formula C6H2F12 and a molecular weight of 302.06 g/mol. Its IUPAC name is 1,1,1,2,3,4,5,5,5-nonafluoro-2-(trifluoromethyl)pentane.
| Compound Name | 1,1,1,2,3,4,5,5,5-nonafluoro-2-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 3020925 |
| Molecular Formula | C6H2F12 |
| Molecular Weight | 302.06 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 1,1,1,2,3,4,5,5,5-nonafluoro-2-(trifluoromethyl)pentane |
| SMILES | FC(C(F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H2F12/c7-1(2(8)4(10,11)12)3(9,5(13,14)15)6(16,17)18/h1-2H |
| InChIKey | JTAGPVKELVRAHG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.06 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |