About 3-(4-fluorophenyl)-2,3-dihydro-1H-inden-1-ol
3-(4-fluorophenyl)-2,3-dihydro-1H-inden-1-ol (PubChem CID 3020939) has the molecular formula C15H13FO
and a molecular weight of 228.27 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 3020939 |
| Molecular Formula | C15H13FO |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 3-(4-fluorophenyl)-2,3-dihydro-1H-inden-1-ol |
| SMILES | OC1CC(c2ccc(F)cc2)c2ccccc21 |
| InChI | InChI=1S/C15H13FO/c16-11-7-5-10(6-8-11)14-9-15(17)13-4-2-1-3-12(13)14/h1-8,14-15,17H,9H2 |
| InChIKey | UGJGBFDLCVVAQK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(4-fluorophenyl)-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of 3-(4-fluorophenyl)-2,3-dihydro-1H-inden-1-ol (CID 3020939) is 3-(4-fluorophenyl)-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for 3-(4-fluorophenyl)-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for 3-(4-fluorophenyl)-2,3-dihydro-1H-inden-1-ol is OC1CC(c2ccc(F)cc2)c2ccccc21.
What is the InChIKey of 3-(4-fluorophenyl)-2,3-dihydro-1H-inden-1-ol?
The InChIKey is UGJGBFDLCVVAQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13FO/c16-11-7-5-10(6-8-11)14-9-15(17)13-4-2-1-3-12(13)14/h1-8,14-15,17H,9H2.
What are the key properties of 3-(4-fluorophenyl)-2,3-dihydro-1H-inden-1-ol?
3-(4-fluorophenyl)-2,3-dihydro-1H-inden-1-ol has a molecular weight of 228.27 g/mol, XLogP of 3.39, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 3020939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).