C20H42O — CID 3020977
3,7,11,15-tetramethylhexadecan-3-ol (PubChem CID 3020977) has the molecular formula C20H42O and a molecular weight of 298.56 g/mol. Its IUPAC name is 3,7,11,15-tetramethylhexadecan-3-ol.
| Compound Name | 3,7,11,15-tetramethylhexadecan-3-ol |
|---|---|
| PubChem CID | 3020977 |
| Molecular Formula | C20H42O |
| Molecular Weight | 298.56 g/mol |
| Exact Mass | 298.32 |
| IUPAC Name | 3,7,11,15-tetramethylhexadecan-3-ol |
| SMILES | CCC(C)(O)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C20H42O/c1-7-20(6,21)16-10-15-19(5)14-9-13-18(4)12-8-11-17(2)3/h17-19,21H,7-16H2,1-6H3 |
| InChIKey | CVPIIXFZNPKANT-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.56 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |