C23H23N3O7S2 — CID 30209831
2-[N-(benzenesulfonyl)-4-nitroanilino]-N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]acetamide (PubChem CID 30209831) has the molecular formula C23H23N3O7S2 and a molecular weight of 517.59 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 30209831 |
| Molecular Formula | C23H23N3O7S2 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]acetamide |
| SMILES | C[C@H](NC(=O)CN(c1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccccc1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C23H23N3O7S2/c1-17(18-8-14-21(15-9-18)34(2,30)31)24-23(27)16-25(19-10-12-20(13-11-19)26(28)29)35(32,33)22-6-4-3-5-7-22/h3-15,17H,16H2,1-2H3,(H,24,27)/t17-/m0/s1 |
| InChIKey | SGTNQALBPMOUGD-KRWDZBQOSA-N |
| XLogP | 3.07 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|