About 1,2,3-trimethoxypropane
1,2,3-trimethoxypropane (PubChem CID 30210) has the molecular formula C6H14O3
and a molecular weight of 134.18 g/mol. Its IUPAC name is 1,2,3-trimethoxypropane.
Molecular Properties
| Compound Name | 1,2,3-trimethoxypropane |
| PubChem CID | 30210 |
| Molecular Formula | C6H14O3 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.09 |
| IUPAC Name | 1,2,3-trimethoxypropane |
| SMILES | COCC(COC)OC |
| InChI | InChI=1S/C6H14O3/c1-7-4-6(9-3)5-8-2/h6H,4-5H2,1-3H3 |
| InChIKey | CAYMIAFKNJGSOR-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2,3-trimethoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-trimethoxypropane?
The IUPAC name of 1,2,3-trimethoxypropane (CID 30210) is 1,2,3-trimethoxypropane.
What is the SMILES notation for 1,2,3-trimethoxypropane?
The canonical SMILES for 1,2,3-trimethoxypropane is COCC(COC)OC.
What is the InChIKey of 1,2,3-trimethoxypropane?
The InChIKey is CAYMIAFKNJGSOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O3/c1-7-4-6(9-3)5-8-2/h6H,4-5H2,1-3H3.
What are the key properties of 1,2,3-trimethoxypropane?
1,2,3-trimethoxypropane has a molecular weight of 134.18 g/mol, XLogP of 0.29, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-trimethoxypropane is sourced from PubChem (CID 30210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).