C13H21NO — CID 3021241
2-(propylaminomethyl)-2,3,4,5,6,7-hexahydroinden-1-one (PubChem CID 3021241) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 2-(propylaminomethyl)-2,3,4,5,6,7-hexahydroinden-1-one.
| Compound Name | 2-(propylaminomethyl)-2,3,4,5,6,7-hexahydroinden-1-one |
|---|---|
| PubChem CID | 3021241 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 2-(propylaminomethyl)-2,3,4,5,6,7-hexahydroinden-1-one |
| SMILES | CCCNCC1CC2=C(CCCC2)C1=O |
| InChI | InChI=1S/C13H21NO/c1-2-7-14-9-11-8-10-5-3-4-6-12(10)13(11)15/h11,14H,2-9H2,1H3 |
| InChIKey | QQWLOKQDZLULQU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|