About ethyl 7-imidazol-1-yl-5,6-dihydronaphthalene-2-carboxylate
ethyl 7-imidazol-1-yl-5,6-dihydronaphthalene-2-carboxylate (PubChem CID 3021566) has the molecular formula C16H16N2O2
and a molecular weight of 268.32 g/mol. Its IUPAC name is ethyl 7-imidazol-1-yl-5,6-dihydronaphthalene-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-imidazol-1-yl-5,6-dihydronaphthalene-2-carboxylate |
| PubChem CID | 3021566 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | ethyl 7-imidazol-1-yl-5,6-dihydronaphthalene-2-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)C=C(n1ccnc1)CC2 |
| InChI | InChI=1S/C16H16N2O2/c1-2-20-16(19)13-4-3-12-5-6-15(10-14(12)9-13)18-8-7-17-11-18/h3-4,7-11H,2,5-6H2,1H3 |
| InChIKey | HUZBRJVXYZZTRG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 7-imidazol-1-yl-5,6-dihydronaphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-imidazol-1-yl-5,6-dihydronaphthalene-2-carboxylate?
The IUPAC name of ethyl 7-imidazol-1-yl-5,6-dihydronaphthalene-2-carboxylate (CID 3021566) is ethyl 7-imidazol-1-yl-5,6-dihydronaphthalene-2-carboxylate.
What is the SMILES notation for ethyl 7-imidazol-1-yl-5,6-dihydronaphthalene-2-carboxylate?
The canonical SMILES for ethyl 7-imidazol-1-yl-5,6-dihydronaphthalene-2-carboxylate is CCOC(=O)c1ccc2c(c1)C=C(n1ccnc1)CC2.
What is the InChIKey of ethyl 7-imidazol-1-yl-5,6-dihydronaphthalene-2-carboxylate?
The InChIKey is HUZBRJVXYZZTRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2/c1-2-20-16(19)13-4-3-12-5-6-15(10-14(12)9-13)18-8-7-17-11-18/h3-4,7-11H,2,5-6H2,1H3.
What are the key properties of ethyl 7-imidazol-1-yl-5,6-dihydronaphthalene-2-carboxylate?
ethyl 7-imidazol-1-yl-5,6-dihydronaphthalene-2-carboxylate has a molecular weight of 268.32 g/mol, XLogP of 3.00, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-imidazol-1-yl-5,6-dihydronaphthalene-2-carboxylate is sourced from PubChem (CID 3021566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).