About 5-ethyl-3,6-dimethyl-1H-pyrimidine-2,4-dione
5-ethyl-3,6-dimethyl-1H-pyrimidine-2,4-dione (PubChem CID 3021669) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 5-ethyl-3,6-dimethyl-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-ethyl-3,6-dimethyl-1H-pyrimidine-2,4-dione |
| PubChem CID | 3021669 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 5-ethyl-3,6-dimethyl-1H-pyrimidine-2,4-dione |
| SMILES | CCc1c(C)[nH]c(=O)n(C)c1=O |
| InChI | InChI=1S/C8H12N2O2/c1-4-6-5(2)9-8(12)10(3)7(6)11/h4H2,1-3H3,(H,9,12) |
| InChIKey | OOKYGLJIVQNEGX-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethyl-3,6-dimethyl-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-3,6-dimethyl-1H-pyrimidine-2,4-dione?
The IUPAC name of 5-ethyl-3,6-dimethyl-1H-pyrimidine-2,4-dione (CID 3021669) is 5-ethyl-3,6-dimethyl-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 5-ethyl-3,6-dimethyl-1H-pyrimidine-2,4-dione?
The canonical SMILES for 5-ethyl-3,6-dimethyl-1H-pyrimidine-2,4-dione is CCc1c(C)[nH]c(=O)n(C)c1=O.
What is the InChIKey of 5-ethyl-3,6-dimethyl-1H-pyrimidine-2,4-dione?
The InChIKey is OOKYGLJIVQNEGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-4-6-5(2)9-8(12)10(3)7(6)11/h4H2,1-3H3,(H,9,12).
What are the key properties of 5-ethyl-3,6-dimethyl-1H-pyrimidine-2,4-dione?
5-ethyl-3,6-dimethyl-1H-pyrimidine-2,4-dione has a molecular weight of 168.20 g/mol, XLogP of -0.06, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-3,6-dimethyl-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 3021669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).