About ethyl 3-ethylsulfanylbutanoate
ethyl 3-ethylsulfanylbutanoate (PubChem CID 3021670) has the molecular formula C8H16O2S
and a molecular weight of 176.28 g/mol. Its IUPAC name is ethyl 3-ethylsulfanylbutanoate.
Molecular Properties
| Compound Name | ethyl 3-ethylsulfanylbutanoate |
| PubChem CID | 3021670 |
| Molecular Formula | C8H16O2S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | ethyl 3-ethylsulfanylbutanoate |
| SMILES | CCOC(=O)CC(C)SCC |
| InChI | InChI=1S/C8H16O2S/c1-4-10-8(9)6-7(3)11-5-2/h7H,4-6H2,1-3H3 |
| InChIKey | JMXMTQDOJYBDSL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-ethylsulfanylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-ethylsulfanylbutanoate?
The IUPAC name of ethyl 3-ethylsulfanylbutanoate (CID 3021670) is ethyl 3-ethylsulfanylbutanoate.
What is the SMILES notation for ethyl 3-ethylsulfanylbutanoate?
The canonical SMILES for ethyl 3-ethylsulfanylbutanoate is CCOC(=O)CC(C)SCC.
What is the InChIKey of ethyl 3-ethylsulfanylbutanoate?
The InChIKey is JMXMTQDOJYBDSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2S/c1-4-10-8(9)6-7(3)11-5-2/h7H,4-6H2,1-3H3.
What are the key properties of ethyl 3-ethylsulfanylbutanoate?
ethyl 3-ethylsulfanylbutanoate has a molecular weight of 176.28 g/mol, XLogP of 2.08, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-ethylsulfanylbutanoate is sourced from PubChem (CID 3021670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).