C21H21N — CID 3021794
2-methyl-1-phenyl-5-(5,6,7,8-tetrahydronaphthalen-2-yl)pyrrole (PubChem CID 3021794) has the molecular formula C21H21N and a molecular weight of 287.41 g/mol. Its IUPAC name is 2-methyl-1-phenyl-5-(5,6,7,8-tetrahydronaphthalen-2-yl)pyrrole.
| Compound Name | 2-methyl-1-phenyl-5-(5,6,7,8-tetrahydronaphthalen-2-yl)pyrrole |
|---|---|
| PubChem CID | 3021794 |
| Molecular Formula | C21H21N |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 2-methyl-1-phenyl-5-(5,6,7,8-tetrahydronaphthalen-2-yl)pyrrole |
| SMILES | Cc1ccc(-c2ccc3c(c2)CCCC3)n1-c1ccccc1 |
| InChI | InChI=1S/C21H21N/c1-16-11-14-21(22(16)20-9-3-2-4-10-20)19-13-12-17-7-5-6-8-18(17)15-19/h2-4,9-15H,5-8H2,1H3 |
| InChIKey | ZTYZTEDUJVTPID-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|