C22H20F3N — CID 3021796
2-methyl-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1-[3-(trifluoromethyl)phenyl]pyrrole (PubChem CID 3021796) has the molecular formula C22H20F3N and a molecular weight of 355.40 g/mol. Its IUPAC name is 2-methyl-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1-[3-(trifluoromethyl)phenyl]pyrrole.
| Compound Name | 2-methyl-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1-[3-(trifluoromethyl)phenyl]pyrrole |
|---|---|
| PubChem CID | 3021796 |
| Molecular Formula | C22H20F3N |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-methyl-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1-[3-(trifluoromethyl)phenyl]pyrrole |
| SMILES | Cc1ccc(-c2ccc3c(c2)CCCC3)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H20F3N/c1-15-9-12-21(18-11-10-16-5-2-3-6-17(16)13-18)26(15)20-8-4-7-19(14-20)22(23,24)25/h4,7-14H,2-3,5-6H2,1H3 |
| InChIKey | IUVZDFSSVXKHOG-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|