About 2-(5-methylthiophen-2-yl)-1,5-diphenylpyrrole
2-(5-methylthiophen-2-yl)-1,5-diphenylpyrrole (PubChem CID 3021802) has the molecular formula C21H17NS
and a molecular weight of 315.44 g/mol. Its IUPAC name is 2-(5-methylthiophen-2-yl)-1,5-diphenylpyrrole.
Molecular Properties
| Compound Name | 2-(5-methylthiophen-2-yl)-1,5-diphenylpyrrole |
| PubChem CID | 3021802 |
| Molecular Formula | C21H17NS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-(5-methylthiophen-2-yl)-1,5-diphenylpyrrole |
| SMILES | Cc1ccc(-c2ccc(-c3ccccc3)n2-c2ccccc2)s1 |
| InChI | InChI=1S/C21H17NS/c1-16-12-15-21(23-16)20-14-13-19(17-8-4-2-5-9-17)22(20)18-10-6-3-7-11-18/h2-15H,1H3 |
| InChIKey | BYHDOXZPCMCKCN-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(5-methylthiophen-2-yl)-1,5-diphenylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methylthiophen-2-yl)-1,5-diphenylpyrrole?
The IUPAC name of 2-(5-methylthiophen-2-yl)-1,5-diphenylpyrrole (CID 3021802) is 2-(5-methylthiophen-2-yl)-1,5-diphenylpyrrole.
What is the SMILES notation for 2-(5-methylthiophen-2-yl)-1,5-diphenylpyrrole?
The canonical SMILES for 2-(5-methylthiophen-2-yl)-1,5-diphenylpyrrole is Cc1ccc(-c2ccc(-c3ccccc3)n2-c2ccccc2)s1.
What is the InChIKey of 2-(5-methylthiophen-2-yl)-1,5-diphenylpyrrole?
The InChIKey is BYHDOXZPCMCKCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17NS/c1-16-12-15-21(23-16)20-14-13-19(17-8-4-2-5-9-17)22(20)18-10-6-3-7-11-18/h2-15H,1H3.
What are the key properties of 2-(5-methylthiophen-2-yl)-1,5-diphenylpyrrole?
2-(5-methylthiophen-2-yl)-1,5-diphenylpyrrole has a molecular weight of 315.44 g/mol, XLogP of 6.18, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methylthiophen-2-yl)-1,5-diphenylpyrrole is sourced from PubChem (CID 3021802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).