About Uracil, 3-butyl-5-isobutyl-6-methyl-
Uracil, 3-butyl-5-isobutyl-6-methyl- (PubChem CID 3021919) has the molecular formula C13H22N2O2
and a molecular weight of 238.33 g/mol. Its IUPAC name is 3-butyl-6-methyl-5-(2-methylpropyl)-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | Uracil, 3-butyl-5-isobutyl-6-methyl- |
| PubChem CID | 3021919 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 3-butyl-6-methyl-5-(2-methylpropyl)-1H-pyrimidine-2,4-dione |
| SMILES | CCCCN1C(=O)C(=C(NC1=O)C)CC(C)C |
| InChI | InChI=1S/C13H22N2O2/c1-5-6-7-15-12(16)11(8-9(2)3)10(4)14-13(15)17/h9H,5-8H2,1-4H3,(H,14,17) |
| InChIKey | MDTBOWUPXIRDGP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | 345 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Uracil, 3-butyl-5-isobutyl-6-methyl- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Uracil, 3-butyl-5-isobutyl-6-methyl-?
The IUPAC name of Uracil, 3-butyl-5-isobutyl-6-methyl- (CID 3021919) is 3-butyl-6-methyl-5-(2-methylpropyl)-1H-pyrimidine-2,4-dione.
What is the SMILES notation for Uracil, 3-butyl-5-isobutyl-6-methyl-?
The canonical SMILES for Uracil, 3-butyl-5-isobutyl-6-methyl- is CCCCN1C(=O)C(=C(NC1=O)C)CC(C)C.
What is the InChIKey of Uracil, 3-butyl-5-isobutyl-6-methyl-?
The InChIKey is MDTBOWUPXIRDGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O2/c1-5-6-7-15-12(16)11(8-9(2)3)10(4)14-13(15)17/h9H,5-8H2,1-4H3,(H,14,17).
What are the key properties of Uracil, 3-butyl-5-isobutyl-6-methyl-?
Uracil, 3-butyl-5-isobutyl-6-methyl- has a molecular weight of 238.33 g/mol, XLogP of 2.40, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Uracil, 3-butyl-5-isobutyl-6-methyl- is sourced from PubChem (CID 3021919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).