C18H21ClN2O5S2 — CID 30219626
2-(2-chloro-N-methylsulfonylanilino)-N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]acetamide (PubChem CID 30219626) has the molecular formula C18H21ClN2O5S2 and a molecular weight of 444.96 g/mol. Its IUPAC name is 2-(2-chloro-N-methylsulfonylanilino)-N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]acetamide.
| Compound Name | 2-(2-chloro-N-methylsulfonylanilino)-N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 30219626 |
| Molecular Formula | C18H21ClN2O5S2 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 2-(2-chloro-N-methylsulfonylanilino)-N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]acetamide |
| SMILES | C[C@H](NC(=O)CN(c1ccccc1Cl)S(C)(=O)=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H21ClN2O5S2/c1-13(14-8-10-15(11-9-14)27(2,23)24)20-18(22)12-21(28(3,25)26)17-7-5-4-6-16(17)19/h4-11,13H,12H2,1-3H3,(H,20,22)/t13-/m0/s1 |
| InChIKey | NJNJZBDFRLBOHS-ZDUSSCGKSA-N |
| XLogP | 2.39 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |