C10H6F4N2O2 — CID 3022015
3-[4-fluoro-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione (PubChem CID 3022015) has the molecular formula C10H6F4N2O2 and a molecular weight of 262.16 g/mol. Its IUPAC name is 3-[4-fluoro-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 3-[4-fluoro-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 3022015 |
| Molecular Formula | C10H6F4N2O2 |
| Molecular Weight | 262.16 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 3-[4-fluoro-3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H6F4N2O2/c11-7-2-1-5(3-6(7)10(12,13)14)16-8(17)4-15-9(16)18/h1-3H,4H2,(H,15,18) |
| InChIKey | GOVWGNBMVWHZIZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.16 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|