C6H4Na2O8S2 — CID 3022572
disodium;2,5-dihydroxybenzene-1,3-disulfonate (PubChem CID 3022572) has the molecular formula C6H4Na2O8S2 and a molecular weight of 314.20 g/mol. Its IUPAC name is disodium;2,5-dihydroxybenzene-1,3-disulfonate.
| Compound Name | disodium;2,5-dihydroxybenzene-1,3-disulfonate |
|---|---|
| PubChem CID | 3022572 |
| Molecular Formula | C6H4Na2O8S2 |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 313.91 |
| IUPAC Name | disodium;2,5-dihydroxybenzene-1,3-disulfonate |
| SMILES | O=S(=O)([O-])c1cc(O)cc(S(=O)(=O)[O-])c1O.[Na+].[Na+] |
| InChI | InChI=1S/C6H6O8S2.2Na/c7-3-1-4(15(9,10)11)6(8)5(2-3)16(12,13)14;;/h1-2,7-8H,(H,9,10,11)(H,12,13,14);;/q;2*+1/p-2 |
| InChIKey | XYYHOGSZZTXVFK-UHFFFAOYSA-L |
| XLogP | -7.09 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | -7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|