About 7-(1-ethoxyethoxy)-3,7-dimethyloctanal
7-(1-ethoxyethoxy)-3,7-dimethyloctanal (PubChem CID 3022715) has the molecular formula C14H28O3
and a molecular weight of 244.37 g/mol. Its IUPAC name is 7-(1-ethoxyethoxy)-3,7-dimethyloctanal.
Molecular Properties
| Compound Name | 7-(1-ethoxyethoxy)-3,7-dimethyloctanal |
| PubChem CID | 3022715 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 7-(1-ethoxyethoxy)-3,7-dimethyloctanal |
| SMILES | CCOC(C)OC(C)(C)CCCC(C)CC=O |
| InChI | InChI=1S/C14H28O3/c1-6-16-13(3)17-14(4,5)10-7-8-12(2)9-11-15/h11-13H,6-10H2,1-5H3 |
| InChIKey | WFYJZJGLGJDJFM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 7-(1-ethoxyethoxy)-3,7-dimethyloctanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(1-ethoxyethoxy)-3,7-dimethyloctanal?
The IUPAC name of 7-(1-ethoxyethoxy)-3,7-dimethyloctanal (CID 3022715) is 7-(1-ethoxyethoxy)-3,7-dimethyloctanal.
What is the SMILES notation for 7-(1-ethoxyethoxy)-3,7-dimethyloctanal?
The canonical SMILES for 7-(1-ethoxyethoxy)-3,7-dimethyloctanal is CCOC(C)OC(C)(C)CCCC(C)CC=O.
What is the InChIKey of 7-(1-ethoxyethoxy)-3,7-dimethyloctanal?
The InChIKey is WFYJZJGLGJDJFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O3/c1-6-16-13(3)17-14(4,5)10-7-8-12(2)9-11-15/h11-13H,6-10H2,1-5H3.
What are the key properties of 7-(1-ethoxyethoxy)-3,7-dimethyloctanal?
7-(1-ethoxyethoxy)-3,7-dimethyloctanal has a molecular weight of 244.37 g/mol, XLogP of 3.56, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(1-ethoxyethoxy)-3,7-dimethyloctanal is sourced from PubChem (CID 3022715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).