C20H25N2O5P — CID 3022732
N-(4-methoxyphenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine;phosphoric acid (PubChem CID 3022732) has the molecular formula C20H25N2O5P and a molecular weight of 404.40 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine;phosphoric acid.
| Compound Name | N-(4-methoxyphenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine;phosphoric acid |
|---|---|
| PubChem CID | 3022732 |
| Molecular Formula | C20H25N2O5P |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N-(4-methoxyphenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine;phosphoric acid |
| SMILES | COc1ccc(/N=C/C=C2N(C)c3ccccc3C2(C)C)cc1.O=P(O)(O)O |
| InChI | InChI=1S/C20H22N2O.H3O4P/c1-20(2)17-7-5-6-8-18(17)22(3)19(20)13-14-21-15-9-11-16(23-4)12-10-15;1-5(2,3)4/h5-14H,1-4H3;(H3,1,2,3,4)/b19-13?,21-14+; |
| InChIKey | BSLGZRUHOXTFNE-YEYRTZHDSA-N |
| XLogP | 3.78 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|