About 8-methoxy-2,4-dimethyloct-3-ene
8-methoxy-2,4-dimethyloct-3-ene (PubChem CID 3022779) has the molecular formula C11H22O
and a molecular weight of 170.30 g/mol. Its IUPAC name is 8-methoxy-2,4-dimethyloct-3-ene.
Molecular Properties
| Compound Name | 8-methoxy-2,4-dimethyloct-3-ene |
| PubChem CID | 3022779 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | 8-methoxy-2,4-dimethyloct-3-ene |
| SMILES | COCCCCC(C)=CC(C)C |
| InChI | InChI=1S/C11H22O/c1-10(2)9-11(3)7-5-6-8-12-4/h9-10H,5-8H2,1-4H3 |
| InChIKey | ZIBNNFGZMSQJND-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-methoxy-2,4-dimethyloct-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-2,4-dimethyloct-3-ene?
The IUPAC name of 8-methoxy-2,4-dimethyloct-3-ene (CID 3022779) is 8-methoxy-2,4-dimethyloct-3-ene.
What is the SMILES notation for 8-methoxy-2,4-dimethyloct-3-ene?
The canonical SMILES for 8-methoxy-2,4-dimethyloct-3-ene is COCCCCC(C)=CC(C)C.
What is the InChIKey of 8-methoxy-2,4-dimethyloct-3-ene?
The InChIKey is ZIBNNFGZMSQJND-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O/c1-10(2)9-11(3)7-5-6-8-12-4/h9-10H,5-8H2,1-4H3.
What are the key properties of 8-methoxy-2,4-dimethyloct-3-ene?
8-methoxy-2,4-dimethyloct-3-ene has a molecular weight of 170.30 g/mol, XLogP of 3.41, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-2,4-dimethyloct-3-ene is sourced from PubChem (CID 3022779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).