C28H32N2O5S — CID 30227923
N-(4-cyclopentyloxyphenyl)-2-(N-(4-ethoxyphenyl)sulfonyl-4-methylanilino)acetamide (PubChem CID 30227923) has the molecular formula C28H32N2O5S and a molecular weight of 508.64 g/mol. Its IUPAC name is N-(4-cyclopentyloxyphenyl)-2-(N-(4-ethoxyphenyl)sulfonyl-4-methylanilino)acetamide.
| Compound Name | N-(4-cyclopentyloxyphenyl)-2-(N-(4-ethoxyphenyl)sulfonyl-4-methylanilino)acetamide |
|---|---|
| PubChem CID | 30227923 |
| Molecular Formula | C28H32N2O5S |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | N-(4-cyclopentyloxyphenyl)-2-(N-(4-ethoxyphenyl)sulfonyl-4-methylanilino)acetamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(CC(=O)Nc2ccc(OC3CCCC3)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H32N2O5S/c1-3-34-24-16-18-27(19-17-24)36(32,33)30(23-12-8-21(2)9-13-23)20-28(31)29-22-10-14-26(15-11-22)35-25-6-4-5-7-25/h8-19,25H,3-7,20H2,1-2H3,(H,29,31) |
| InChIKey | YQWDXMKZLDYLTG-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |