C25H26Cl2N2O4S — CID 30228380
N-[3-(2-chlorophenyl)propyl]-2-(N-(4-chlorophenyl)sulfonyl-4-ethoxyanilino)acetamide (PubChem CID 30228380) has the molecular formula C25H26Cl2N2O4S and a molecular weight of 521.47 g/mol. Its IUPAC name is N-[3-(2-chlorophenyl)propyl]-2-(N-(4-chlorophenyl)sulfonyl-4-ethoxyanilino)acetamide.
| Compound Name | N-[3-(2-chlorophenyl)propyl]-2-(N-(4-chlorophenyl)sulfonyl-4-ethoxyanilino)acetamide |
|---|---|
| PubChem CID | 30228380 |
| Molecular Formula | C25H26Cl2N2O4S |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 520.10 |
| IUPAC Name | N-[3-(2-chlorophenyl)propyl]-2-(N-(4-chlorophenyl)sulfonyl-4-ethoxyanilino)acetamide |
| SMILES | CCOc1ccc(N(CC(=O)NCCCc2ccccc2Cl)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H26Cl2N2O4S/c1-2-33-22-13-11-21(12-14-22)29(34(31,32)23-15-9-20(26)10-16-23)18-25(30)28-17-5-7-19-6-3-4-8-24(19)27/h3-4,6,8-16H,2,5,7,17-18H2,1H3,(H,28,30) |
| InChIKey | QTGZMAXACDWQNR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|