About 1-(3,7-dimethyloct-6-enoxy)-1-methoxydecane
1-(3,7-dimethyloct-6-enoxy)-1-methoxydecane (PubChem CID 3022844) has the molecular formula C21H42O2
and a molecular weight of 326.57 g/mol. Its IUPAC name is 1-(3,7-dimethyloct-6-enoxy)-1-methoxydecane.
Molecular Properties
| Compound Name | 1-(3,7-dimethyloct-6-enoxy)-1-methoxydecane |
| PubChem CID | 3022844 |
| Molecular Formula | C21H42O2 |
| Molecular Weight | 326.57 g/mol |
| Exact Mass | 326.32 |
| IUPAC Name | 1-(3,7-dimethyloct-6-enoxy)-1-methoxydecane |
| SMILES | CCCCCCCCCC(OC)OCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C21H42O2/c1-6-7-8-9-10-11-12-16-21(22-5)23-18-17-20(4)15-13-14-19(2)3/h14,20-21H,6-13,15-18H2,1-5H3 |
| InChIKey | JVPUXLNHNKOZAQ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.57 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,7-dimethyloct-6-enoxy)-1-methoxydecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,7-dimethyloct-6-enoxy)-1-methoxydecane?
The IUPAC name of 1-(3,7-dimethyloct-6-enoxy)-1-methoxydecane (CID 3022844) is 1-(3,7-dimethyloct-6-enoxy)-1-methoxydecane.
What is the SMILES notation for 1-(3,7-dimethyloct-6-enoxy)-1-methoxydecane?
The canonical SMILES for 1-(3,7-dimethyloct-6-enoxy)-1-methoxydecane is CCCCCCCCCC(OC)OCCC(C)CCC=C(C)C.
What is the InChIKey of 1-(3,7-dimethyloct-6-enoxy)-1-methoxydecane?
The InChIKey is JVPUXLNHNKOZAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42O2/c1-6-7-8-9-10-11-12-16-21(22-5)23-18-17-20(4)15-13-14-19(2)3/h14,20-21H,6-13,15-18H2,1-5H3.
What are the key properties of 1-(3,7-dimethyloct-6-enoxy)-1-methoxydecane?
1-(3,7-dimethyloct-6-enoxy)-1-methoxydecane has a molecular weight of 326.57 g/mol, XLogP of 6.89, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,7-dimethyloct-6-enoxy)-1-methoxydecane is sourced from PubChem (CID 3022844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).