C7H9F8NO3S — CID 3022847
1,1,2,2,3,3,4,4-octafluoro-N-(2-hydroxyethyl)-N-methylbutane-1-sulfonamide (PubChem CID 3022847) has the molecular formula C7H9F8NO3S and a molecular weight of 339.20 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluoro-N-(2-hydroxyethyl)-N-methylbutane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3,4,4-octafluoro-N-(2-hydroxyethyl)-N-methylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 3022847 |
| Molecular Formula | C7H9F8NO3S |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluoro-N-(2-hydroxyethyl)-N-methylbutane-1-sulfonamide |
| SMILES | CN(CCO)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H9F8NO3S/c1-16(2-3-17)20(18,19)7(14,15)6(12,13)5(10,11)4(8)9/h4,17H,2-3H2,1H3 |
| InChIKey | HVRZEMISTDPHLI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|