About 7-chloro-1,1-dimethyl-2,3-dihydroinden-4-ol
7-chloro-1,1-dimethyl-2,3-dihydroinden-4-ol (PubChem CID 3022861) has the molecular formula C11H13ClO
and a molecular weight of 196.68 g/mol. Its IUPAC name is 7-chloro-1,1-dimethyl-2,3-dihydroinden-4-ol.
Molecular Properties
| Compound Name | 7-chloro-1,1-dimethyl-2,3-dihydroinden-4-ol |
| PubChem CID | 3022861 |
| Molecular Formula | C11H13ClO |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 7-chloro-1,1-dimethyl-2,3-dihydroinden-4-ol |
| SMILES | CC1(C)CCc2c(O)ccc(Cl)c21 |
| InChI | InChI=1S/C11H13ClO/c1-11(2)6-5-7-9(13)4-3-8(12)10(7)11/h3-4,13H,5-6H2,1-2H3 |
| InChIKey | KZOVKESZCFEXNY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-chloro-1,1-dimethyl-2,3-dihydroinden-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-1,1-dimethyl-2,3-dihydroinden-4-ol?
The IUPAC name of 7-chloro-1,1-dimethyl-2,3-dihydroinden-4-ol (CID 3022861) is 7-chloro-1,1-dimethyl-2,3-dihydroinden-4-ol.
What is the SMILES notation for 7-chloro-1,1-dimethyl-2,3-dihydroinden-4-ol?
The canonical SMILES for 7-chloro-1,1-dimethyl-2,3-dihydroinden-4-ol is CC1(C)CCc2c(O)ccc(Cl)c21.
What is the InChIKey of 7-chloro-1,1-dimethyl-2,3-dihydroinden-4-ol?
The InChIKey is KZOVKESZCFEXNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClO/c1-11(2)6-5-7-9(13)4-3-8(12)10(7)11/h3-4,13H,5-6H2,1-2H3.
What are the key properties of 7-chloro-1,1-dimethyl-2,3-dihydroinden-4-ol?
7-chloro-1,1-dimethyl-2,3-dihydroinden-4-ol has a molecular weight of 196.68 g/mol, XLogP of 3.27, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-1,1-dimethyl-2,3-dihydroinden-4-ol is sourced from PubChem (CID 3022861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).