About bis[2-(2-phenylpropan-2-yl)phenyl] benzene-1,3-dicarboxylate
bis[2-(2-phenylpropan-2-yl)phenyl] benzene-1,3-dicarboxylate (PubChem CID 3023047) has the molecular formula C38H34O4
and a molecular weight of 554.69 g/mol. Its IUPAC name is bis[2-(2-phenylpropan-2-yl)phenyl] benzene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | bis[2-(2-phenylpropan-2-yl)phenyl] benzene-1,3-dicarboxylate |
| PubChem CID | 3023047 |
| Molecular Formula | C38H34O4 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | bis[2-(2-phenylpropan-2-yl)phenyl] benzene-1,3-dicarboxylate |
| SMILES | CC(C)(c1ccccc1)c1ccccc1OC(=O)c1cccc(C(=O)Oc2ccccc2C(C)(C)c2ccccc2)c1 |
| InChI | InChI=1S/C38H34O4/c1-37(2,29-18-7-5-8-19-29)31-22-11-13-24-33(31)41-35(39)27-16-15-17-28(26-27)36(40)42-34-25-14-12-23-32(34)38(3,4)30-20-9-6-10-21-30/h5-26H,1-4H3 |
| InChIKey | WDBRYIRIVBADDQ-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze bis[2-(2-phenylpropan-2-yl)phenyl] benzene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-(2-phenylpropan-2-yl)phenyl] benzene-1,3-dicarboxylate?
The IUPAC name of bis[2-(2-phenylpropan-2-yl)phenyl] benzene-1,3-dicarboxylate (CID 3023047) is bis[2-(2-phenylpropan-2-yl)phenyl] benzene-1,3-dicarboxylate.
What is the SMILES notation for bis[2-(2-phenylpropan-2-yl)phenyl] benzene-1,3-dicarboxylate?
The canonical SMILES for bis[2-(2-phenylpropan-2-yl)phenyl] benzene-1,3-dicarboxylate is CC(C)(c1ccccc1)c1ccccc1OC(=O)c1cccc(C(=O)Oc2ccccc2C(C)(C)c2ccccc2)c1.
What is the InChIKey of bis[2-(2-phenylpropan-2-yl)phenyl] benzene-1,3-dicarboxylate?
The InChIKey is WDBRYIRIVBADDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H34O4/c1-37(2,29-18-7-5-8-19-29)31-22-11-13-24-33(31)41-35(39)27-16-15-17-28(26-27)36(40)42-34-25-14-12-23-32(34)38(3,4)30-20-9-6-10-21-30/h5-26H,1-4H3.
What are the key properties of bis[2-(2-phenylpropan-2-yl)phenyl] benzene-1,3-dicarboxylate?
bis[2-(2-phenylpropan-2-yl)phenyl] benzene-1,3-dicarboxylate has a molecular weight of 554.69 g/mol, XLogP of 8.78, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-(2-phenylpropan-2-yl)phenyl] benzene-1,3-dicarboxylate is sourced from PubChem (CID 3023047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).