About 1-cyclohexylethyl ethyl carbonate
1-cyclohexylethyl ethyl carbonate (PubChem CID 3023090) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is 1-cyclohexylethyl ethyl carbonate.
Molecular Properties
| Compound Name | 1-cyclohexylethyl ethyl carbonate |
| PubChem CID | 3023090 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 1-cyclohexylethyl ethyl carbonate |
| SMILES | CCOC(=O)OC(C)C1CCCCC1 |
| InChI | InChI=1S/C11H20O3/c1-3-13-11(12)14-9(2)10-7-5-4-6-8-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | RMEKEYDDFDWNSG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclohexylethyl ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylethyl ethyl carbonate?
The IUPAC name of 1-cyclohexylethyl ethyl carbonate (CID 3023090) is 1-cyclohexylethyl ethyl carbonate.
What is the SMILES notation for 1-cyclohexylethyl ethyl carbonate?
The canonical SMILES for 1-cyclohexylethyl ethyl carbonate is CCOC(=O)OC(C)C1CCCCC1.
What is the InChIKey of 1-cyclohexylethyl ethyl carbonate?
The InChIKey is RMEKEYDDFDWNSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-3-13-11(12)14-9(2)10-7-5-4-6-8-10/h9-10H,3-8H2,1-2H3.
What are the key properties of 1-cyclohexylethyl ethyl carbonate?
1-cyclohexylethyl ethyl carbonate has a molecular weight of 200.28 g/mol, XLogP of 3.13, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylethyl ethyl carbonate is sourced from PubChem (CID 3023090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).