About diethyl(2-prop-2-enoyloxyethyl)azanium;methyl sulfate
diethyl(2-prop-2-enoyloxyethyl)azanium;methyl sulfate (PubChem CID 3023093) has the molecular formula C10H21NO6S
and a molecular weight of 283.35 g/mol. Its IUPAC name is diethyl(2-prop-2-enoyloxyethyl)azanium;methyl sulfate.
Molecular Properties
| Compound Name | diethyl(2-prop-2-enoyloxyethyl)azanium;methyl sulfate |
| PubChem CID | 3023093 |
| Molecular Formula | C10H21NO6S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | diethyl(2-prop-2-enoyloxyethyl)azanium;methyl sulfate |
| SMILES | C=CC(=O)OCC[NH+](CC)CC.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C9H17NO2.CH4O4S/c1-4-9(11)12-8-7-10(5-2)6-3;1-5-6(2,3)4/h4H,1,5-8H2,2-3H3;1H3,(H,2,3,4) |
| InChIKey | LEBUWCUIVXPUOC-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 97.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze diethyl(2-prop-2-enoyloxyethyl)azanium;methyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl(2-prop-2-enoyloxyethyl)azanium;methyl sulfate?
The IUPAC name of diethyl(2-prop-2-enoyloxyethyl)azanium;methyl sulfate (CID 3023093) is diethyl(2-prop-2-enoyloxyethyl)azanium;methyl sulfate.
What is the SMILES notation for diethyl(2-prop-2-enoyloxyethyl)azanium;methyl sulfate?
The canonical SMILES for diethyl(2-prop-2-enoyloxyethyl)azanium;methyl sulfate is C=CC(=O)OCC[NH+](CC)CC.COS(=O)(=O)[O-].
What is the InChIKey of diethyl(2-prop-2-enoyloxyethyl)azanium;methyl sulfate?
The InChIKey is LEBUWCUIVXPUOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.CH4O4S/c1-4-9(11)12-8-7-10(5-2)6-3;1-5-6(2,3)4/h4H,1,5-8H2,2-3H3;1H3,(H,2,3,4).
What are the key properties of diethyl(2-prop-2-enoyloxyethyl)azanium;methyl sulfate?
diethyl(2-prop-2-enoyloxyethyl)azanium;methyl sulfate has a molecular weight of 283.35 g/mol, XLogP of -1.27, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl(2-prop-2-enoyloxyethyl)azanium;methyl sulfate is sourced from PubChem (CID 3023093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).