C15H23N5O2 — CID 3023150
4-[(1,3-dimethyl-1,2-dihydroimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline acetate (PubChem CID 3023150) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 4-[(1,3-dimethyl-1,2-dihydroimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline acetate.
| Compound Name | 4-[(1,3-dimethyl-1,2-dihydroimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline acetate |
|---|---|
| PubChem CID | 3023150 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 4-[(1,3-dimethyl-1,2-dihydroimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline acetate |
| SMILES | CC(=O)[O-].CN(C)c1ccc(/N=N/C2N(C)C=C[NH+]2C)cc1 |
| InChI | InChI=1S/C13H19N5.C2H4O2/c1-16(2)12-7-5-11(6-8-12)14-15-13-17(3)9-10-18(13)4;1-2(3)4/h5-10,13H,1-4H3;1H3,(H,3,4)/b15-14+; |
| InChIKey | HUHLSRZJJKTPBO-WPDLWGESSA-N |
| XLogP | -0.19 |
| TPSA | 75.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|