About (4-oxopyran-3-yl) 2-methylpropanoate
(4-oxopyran-3-yl) 2-methylpropanoate (PubChem CID 3023313) has the molecular formula C9H10O4
and a molecular weight of 182.18 g/mol. Its IUPAC name is (4-oxopyran-3-yl) 2-methylpropanoate.
Molecular Properties
| Compound Name | (4-oxopyran-3-yl) 2-methylpropanoate |
| PubChem CID | 3023313 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | (4-oxopyran-3-yl) 2-methylpropanoate |
| SMILES | CC(C)C(=O)Oc1coccc1=O |
| InChI | InChI=1S/C9H10O4/c1-6(2)9(11)13-8-5-12-4-3-7(8)10/h3-6H,1-2H3 |
| InChIKey | PVKKITURLYACSF-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-oxopyran-3-yl) 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxopyran-3-yl) 2-methylpropanoate?
The IUPAC name of (4-oxopyran-3-yl) 2-methylpropanoate (CID 3023313) is (4-oxopyran-3-yl) 2-methylpropanoate.
What is the SMILES notation for (4-oxopyran-3-yl) 2-methylpropanoate?
The canonical SMILES for (4-oxopyran-3-yl) 2-methylpropanoate is CC(C)C(=O)Oc1coccc1=O.
What is the InChIKey of (4-oxopyran-3-yl) 2-methylpropanoate?
The InChIKey is PVKKITURLYACSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O4/c1-6(2)9(11)13-8-5-12-4-3-7(8)10/h3-6H,1-2H3.
What are the key properties of (4-oxopyran-3-yl) 2-methylpropanoate?
(4-oxopyran-3-yl) 2-methylpropanoate has a molecular weight of 182.18 g/mol, XLogP of 1.20, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxopyran-3-yl) 2-methylpropanoate is sourced from PubChem (CID 3023313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).