C18H15N3OS2 — CID 30234196
3-[3-[(E)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]propanenitrile (PubChem CID 30234196) has the molecular formula C18H15N3OS2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 3-[3-[(E)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]propanenitrile.
| Compound Name | 3-[3-[(E)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 30234196 |
| Molecular Formula | C18H15N3OS2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 3-[3-[(E)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]propanenitrile |
| SMILES | C=CCN1C(=O)/C(=C\c2cn(CCC#N)c3ccccc23)SC1=S |
| InChI | InChI=1S/C18H15N3OS2/c1-2-9-21-17(22)16(24-18(21)23)11-13-12-20(10-5-8-19)15-7-4-3-6-14(13)15/h2-4,6-7,11-12H,1,5,9-10H2/b16-11+ |
| InChIKey | MKKSGVWRZAGURQ-LFIBNONCSA-N |
| XLogP | 3.94 |
| TPSA | 49.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|