C17H30O2 — CID 3023576
4-ethyl-6-(2,6,6-trimethylcyclohex-2-en-1-yl)hex-2-ene-1,4-diol (PubChem CID 3023576) has the molecular formula C17H30O2 and a molecular weight of 266.43 g/mol. Its IUPAC name is 4-ethyl-6-(2,6,6-trimethylcyclohex-2-en-1-yl)hex-2-ene-1,4-diol.
| Compound Name | 4-ethyl-6-(2,6,6-trimethylcyclohex-2-en-1-yl)hex-2-ene-1,4-diol |
|---|---|
| PubChem CID | 3023576 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 4-ethyl-6-(2,6,6-trimethylcyclohex-2-en-1-yl)hex-2-ene-1,4-diol |
| SMILES | CCC(O)(C=CCO)CCC1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C17H30O2/c1-5-17(19,11-7-13-18)12-9-15-14(2)8-6-10-16(15,3)4/h7-8,11,15,18-19H,5-6,9-10,12-13H2,1-4H3 |
| InChIKey | VGKUDTFPDSFCFQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|