About 1-thiophen-2-ylethyl acetate
1-thiophen-2-ylethyl acetate (PubChem CID 3023725) has the molecular formula C8H10O2S
and a molecular weight of 170.23 g/mol. Its IUPAC name is 1-thiophen-2-ylethyl acetate.
Molecular Properties
| Compound Name | 1-thiophen-2-ylethyl acetate |
| PubChem CID | 3023725 |
| Molecular Formula | C8H10O2S |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 1-thiophen-2-ylethyl acetate |
| SMILES | CC(=O)OC(C)c1cccs1 |
| InChI | InChI=1S/C8H10O2S/c1-6(10-7(2)9)8-4-3-5-11-8/h3-6H,1-2H3 |
| InChIKey | UMPWVJJKMHJYAA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-thiophen-2-ylethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-thiophen-2-ylethyl acetate?
The IUPAC name of 1-thiophen-2-ylethyl acetate (CID 3023725) is 1-thiophen-2-ylethyl acetate.
What is the SMILES notation for 1-thiophen-2-ylethyl acetate?
The canonical SMILES for 1-thiophen-2-ylethyl acetate is CC(=O)OC(C)c1cccs1.
What is the InChIKey of 1-thiophen-2-ylethyl acetate?
The InChIKey is UMPWVJJKMHJYAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2S/c1-6(10-7(2)9)8-4-3-5-11-8/h3-6H,1-2H3.
What are the key properties of 1-thiophen-2-ylethyl acetate?
1-thiophen-2-ylethyl acetate has a molecular weight of 170.23 g/mol, XLogP of 2.37, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-thiophen-2-ylethyl acetate is sourced from PubChem (CID 3023725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).