C27H27N3O2S — CID 30238346
(2R)-2-[3-[(2R)-butan-2-yl]-4-oxoquinazolin-2-yl]sulfanyl-N-(2-phenylphenyl)propanamide (PubChem CID 30238346) has the molecular formula C27H27N3O2S and a molecular weight of 457.60 g/mol. Its IUPAC name is (2R)-2-[3-[(2R)-butan-2-yl]-4-oxoquinazolin-2-yl]sulfanyl-N-(2-phenylphenyl)propanamide.
| Compound Name | (2R)-2-[3-[(2R)-butan-2-yl]-4-oxoquinazolin-2-yl]sulfanyl-N-(2-phenylphenyl)propanamide |
|---|---|
| PubChem CID | 30238346 |
| Molecular Formula | C27H27N3O2S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | (2R)-2-[3-[(2R)-butan-2-yl]-4-oxoquinazolin-2-yl]sulfanyl-N-(2-phenylphenyl)propanamide |
| SMILES | CC[C@@H](C)n1c(S[C@H](C)C(=O)Nc2ccccc2-c2ccccc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C27H27N3O2S/c1-4-18(2)30-26(32)22-15-9-11-17-24(22)29-27(30)33-19(3)25(31)28-23-16-10-8-14-21(23)20-12-6-5-7-13-20/h5-19H,4H2,1-3H3,(H,28,31)/t18-,19-/m1/s1 |
| InChIKey | ZTIHBINCDVWEKP-RTBURBONSA-N |
| XLogP | 6.15 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |