C12H17N3O3S — CID 30238407
2-[[2-[(2S)-2-methylmorpholin-4-yl]acetyl]amino]thiophene-3-carboxamide (PubChem CID 30238407) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-[[2-[(2S)-2-methylmorpholin-4-yl]acetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-[(2S)-2-methylmorpholin-4-yl]acetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 30238407 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-[[2-[(2S)-2-methylmorpholin-4-yl]acetyl]amino]thiophene-3-carboxamide |
| SMILES | C[C@H]1CN(CC(=O)Nc2sccc2C(N)=O)CCO1 |
| InChI | InChI=1S/C12H17N3O3S/c1-8-6-15(3-4-18-8)7-10(16)14-12-9(11(13)17)2-5-19-12/h2,5,8H,3-4,6-7H2,1H3,(H2,13,17)(H,14,16)/t8-/m0/s1 |
| InChIKey | FGPPOEVPFYKLPY-QMMMGPOBSA-N |
| XLogP | 0.51 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |