About 4-methyl-2-phenyloxane
4-methyl-2-phenyloxane (PubChem CID 3024003) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 4-methyl-2-phenyloxane.
Molecular Properties
| Compound Name | 4-methyl-2-phenyloxane |
| PubChem CID | 3024003 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 4-methyl-2-phenyloxane |
| SMILES | CC1CCOC(c2ccccc2)C1 |
| InChI | InChI=1S/C12H16O/c1-10-7-8-13-12(9-10)11-5-3-2-4-6-11/h2-6,10,12H,7-9H2,1H3 |
| InChIKey | GDAVABNCFOTAOD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methyl-2-phenyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-phenyloxane?
The IUPAC name of 4-methyl-2-phenyloxane (CID 3024003) is 4-methyl-2-phenyloxane.
What is the SMILES notation for 4-methyl-2-phenyloxane?
The canonical SMILES for 4-methyl-2-phenyloxane is CC1CCOC(c2ccccc2)C1.
What is the InChIKey of 4-methyl-2-phenyloxane?
The InChIKey is GDAVABNCFOTAOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c1-10-7-8-13-12(9-10)11-5-3-2-4-6-11/h2-6,10,12H,7-9H2,1H3.
What are the key properties of 4-methyl-2-phenyloxane?
4-methyl-2-phenyloxane has a molecular weight of 176.26 g/mol, XLogP of 3.17, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-phenyloxane is sourced from PubChem (CID 3024003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).