About 4-methylpentan-2-yl cyclopentanecarboxylate
4-methylpentan-2-yl cyclopentanecarboxylate (PubChem CID 3024057) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is 4-methylpentan-2-yl cyclopentanecarboxylate.
Molecular Properties
| Compound Name | 4-methylpentan-2-yl cyclopentanecarboxylate |
| PubChem CID | 3024057 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 4-methylpentan-2-yl cyclopentanecarboxylate |
| SMILES | CC(C)CC(C)OC(=O)C1CCCC1 |
| InChI | InChI=1S/C12H22O2/c1-9(2)8-10(3)14-12(13)11-6-4-5-7-11/h9-11H,4-8H2,1-3H3 |
| InChIKey | AGGULZKSGBOSKI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylpentan-2-yl cyclopentanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentan-2-yl cyclopentanecarboxylate?
The IUPAC name of 4-methylpentan-2-yl cyclopentanecarboxylate (CID 3024057) is 4-methylpentan-2-yl cyclopentanecarboxylate.
What is the SMILES notation for 4-methylpentan-2-yl cyclopentanecarboxylate?
The canonical SMILES for 4-methylpentan-2-yl cyclopentanecarboxylate is CC(C)CC(C)OC(=O)C1CCCC1.
What is the InChIKey of 4-methylpentan-2-yl cyclopentanecarboxylate?
The InChIKey is AGGULZKSGBOSKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2/c1-9(2)8-10(3)14-12(13)11-6-4-5-7-11/h9-11H,4-8H2,1-3H3.
What are the key properties of 4-methylpentan-2-yl cyclopentanecarboxylate?
4-methylpentan-2-yl cyclopentanecarboxylate has a molecular weight of 198.31 g/mol, XLogP of 3.15, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentan-2-yl cyclopentanecarboxylate is sourced from PubChem (CID 3024057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).