C21H27BrN2O3S2 — CID 30245173
2-(4-bromo-3-methyl-N-methylsulfonylanilino)-N-[3-[(4-methylphenyl)methylsulfanyl]propyl]acetamide (PubChem CID 30245173) has the molecular formula C21H27BrN2O3S2 and a molecular weight of 499.50 g/mol. Its IUPAC name is 2-(4-bromo-3-methyl-N-methylsulfonylanilino)-N-[3-[(4-methylphenyl)methylsulfanyl]propyl]acetamide.
| Compound Name | 2-(4-bromo-3-methyl-N-methylsulfonylanilino)-N-[3-[(4-methylphenyl)methylsulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 30245173 |
| Molecular Formula | C21H27BrN2O3S2 |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 498.06 |
| IUPAC Name | 2-(4-bromo-3-methyl-N-methylsulfonylanilino)-N-[3-[(4-methylphenyl)methylsulfanyl]propyl]acetamide |
| SMILES | Cc1ccc(CSCCCNC(=O)CN(c2ccc(Br)c(C)c2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H27BrN2O3S2/c1-16-5-7-18(8-6-16)15-28-12-4-11-23-21(25)14-24(29(3,26)27)19-9-10-20(22)17(2)13-19/h5-10,13H,4,11-12,14-15H2,1-3H3,(H,23,25) |
| InChIKey | CMXLKKSLUYPQRL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|