About 2-methyl-2-(pyren-1-ylmethylamino)propane-1,3-diol;hydrochloride
2-methyl-2-(pyren-1-ylmethylamino)propane-1,3-diol;hydrochloride (PubChem CID 3024570) has the molecular formula C21H22ClNO2
and a molecular weight of 355.86 g/mol. Its IUPAC name is 2-methyl-2-(pyren-1-ylmethylamino)propane-1,3-diol;hydrochloride.
Molecular Properties
| Compound Name | 2-methyl-2-(pyren-1-ylmethylamino)propane-1,3-diol;hydrochloride |
| PubChem CID | 3024570 |
| Molecular Formula | C21H22ClNO2 |
| Molecular Weight | 355.86 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 2-methyl-2-(pyren-1-ylmethylamino)propane-1,3-diol;hydrochloride |
| SMILES | CC(CO)(CO)NCc1ccc2ccc3cccc4ccc1c2c34.Cl |
| InChI | InChI=1S/C21H21NO2.ClH/c1-21(12-23,13-24)22-11-17-8-7-16-6-5-14-3-2-4-15-9-10-18(17)20(16)19(14)15;/h2-10,22-24H,11-13H2,1H3;1H |
| InChIKey | ZMNFETLBLNLKSC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.86 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2-(pyren-1-ylmethylamino)propane-1,3-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-(pyren-1-ylmethylamino)propane-1,3-diol;hydrochloride?
The IUPAC name of 2-methyl-2-(pyren-1-ylmethylamino)propane-1,3-diol;hydrochloride (CID 3024570) is 2-methyl-2-(pyren-1-ylmethylamino)propane-1,3-diol;hydrochloride.
What is the SMILES notation for 2-methyl-2-(pyren-1-ylmethylamino)propane-1,3-diol;hydrochloride?
The canonical SMILES for 2-methyl-2-(pyren-1-ylmethylamino)propane-1,3-diol;hydrochloride is CC(CO)(CO)NCc1ccc2ccc3cccc4ccc1c2c34.Cl.
What is the InChIKey of 2-methyl-2-(pyren-1-ylmethylamino)propane-1,3-diol;hydrochloride?
The InChIKey is ZMNFETLBLNLKSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO2.ClH/c1-21(12-23,13-24)22-11-17-8-7-16-6-5-14-3-2-4-15-9-10-18(17)20(16)19(14)15;/h2-10,22-24H,11-13H2,1H3;1H.
What are the key properties of 2-methyl-2-(pyren-1-ylmethylamino)propane-1,3-diol;hydrochloride?
2-methyl-2-(pyren-1-ylmethylamino)propane-1,3-diol;hydrochloride has a molecular weight of 355.86 g/mol, XLogP of 3.84, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-(pyren-1-ylmethylamino)propane-1,3-diol;hydrochloride is sourced from PubChem (CID 3024570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).