About 3-(dimethylamino)-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride
3-(dimethylamino)-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride (PubChem CID 3024638) has the molecular formula C13H29ClN2O
and a molecular weight of 264.84 g/mol. Its IUPAC name is 3-(dimethylamino)-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride.
Molecular Properties
| Compound Name | 3-(dimethylamino)-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride |
| PubChem CID | 3024638 |
| Molecular Formula | C13H29ClN2O |
| Molecular Weight | 264.84 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 3-(dimethylamino)-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride |
| SMILES | CN(C)CCC(=O)NC(C)(C)CC(C)(C)C.Cl |
| InChI | InChI=1S/C13H28N2O.ClH/c1-12(2,3)10-13(4,5)14-11(16)8-9-15(6)7;/h8-10H2,1-7H3,(H,14,16);1H |
| InChIKey | LLVDFVSJWIAJDE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.84 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(dimethylamino)-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride?
The IUPAC name of 3-(dimethylamino)-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride (CID 3024638) is 3-(dimethylamino)-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride.
What is the SMILES notation for 3-(dimethylamino)-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride?
The canonical SMILES for 3-(dimethylamino)-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride is CN(C)CCC(=O)NC(C)(C)CC(C)(C)C.Cl.
What is the InChIKey of 3-(dimethylamino)-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride?
The InChIKey is LLVDFVSJWIAJDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O.ClH/c1-12(2,3)10-13(4,5)14-11(16)8-9-15(6)7;/h8-10H2,1-7H3,(H,14,16);1H.
What are the key properties of 3-(dimethylamino)-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride?
3-(dimethylamino)-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride has a molecular weight of 264.84 g/mol, XLogP of 2.69, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride is sourced from PubChem (CID 3024638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).