About N-(2-cyanoethyl)-N',N'-dimethylpropanehydrazide
N-(2-cyanoethyl)-N',N'-dimethylpropanehydrazide (PubChem CID 3024663) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N',N'-dimethylpropanehydrazide.
Molecular Properties
| Compound Name | N-(2-cyanoethyl)-N',N'-dimethylpropanehydrazide |
|---|
| PubChem CID | 3024663 |
|---|
| Molecular Formula | C8H15N3O |
|---|
| Molecular Weight | 169.23 g/mol |
|---|
| Exact Mass | 169.12 |
|---|
| IUPAC Name | N-(2-cyanoethyl)-N',N'-dimethylpropanehydrazide |
|---|
| SMILES | CCC(=O)N(CCC#N)N(C)C |
|---|
| InChI | InChI=1S/C8H15N3O/c1-4-8(12)11(10(2)3)7-5-6-9/h4-5,7H2,1-3H3 |
|---|
| InChIKey | TUZICURVJCEKLK-UHFFFAOYSA-N |
|---|
| XLogP | 0.62 |
|---|
| TPSA | 47.34 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 3 |
|---|
| Rotatable Bonds | 4 |
|---|
| Heavy Atoms | 12 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-cyanoethyl)-N',N'-dimethylpropanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyanoethyl)-N',N'-dimethylpropanehydrazide?
The IUPAC name of N-(2-cyanoethyl)-N',N'-dimethylpropanehydrazide (CID 3024663) is N-(2-cyanoethyl)-N',N'-dimethylpropanehydrazide.
What is the SMILES notation for N-(2-cyanoethyl)-N',N'-dimethylpropanehydrazide?
The canonical SMILES for N-(2-cyanoethyl)-N',N'-dimethylpropanehydrazide is CCC(=O)N(CCC#N)N(C)C.
What is the InChIKey of N-(2-cyanoethyl)-N',N'-dimethylpropanehydrazide?
The InChIKey is TUZICURVJCEKLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O/c1-4-8(12)11(10(2)3)7-5-6-9/h4-5,7H2,1-3H3.
What are the key properties of N-(2-cyanoethyl)-N',N'-dimethylpropanehydrazide?
N-(2-cyanoethyl)-N',N'-dimethylpropanehydrazide has a molecular weight of 169.23 g/mol, XLogP of 0.62, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyanoethyl)-N',N'-dimethylpropanehydrazide is sourced from PubChem (CID 3024663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).