About N,N-dimethyl-N'-pyridin-2-yl-N'-(selenophen-2-ylmethyl)ethane-1,2-diamine
N,N-dimethyl-N'-pyridin-2-yl-N'-(selenophen-2-ylmethyl)ethane-1,2-diamine (PubChem CID 3024699) has the molecular formula C14H19N3Se
and a molecular weight of 308.29 g/mol. Its IUPAC name is N,N-dimethyl-N'-pyridin-2-yl-N'-(selenophen-2-ylmethyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N,N-dimethyl-N'-pyridin-2-yl-N'-(selenophen-2-ylmethyl)ethane-1,2-diamine |
| PubChem CID | 3024699 |
| Molecular Formula | C14H19N3Se |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | N,N-dimethyl-N'-pyridin-2-yl-N'-(selenophen-2-ylmethyl)ethane-1,2-diamine |
| SMILES | CN(C)CCN(Cc1ccc[se]1)c1ccccn1 |
| InChI | InChI=1S/C14H19N3Se/c1-16(2)9-10-17(12-13-6-5-11-18-13)14-7-3-4-8-15-14/h3-8,11H,9-10,12H2,1-2H3 |
| InChIKey | MRHSQARURHMPOG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-N'-pyridin-2-yl-N'-(selenophen-2-ylmethyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-N'-pyridin-2-yl-N'-(selenophen-2-ylmethyl)ethane-1,2-diamine?
The IUPAC name of N,N-dimethyl-N'-pyridin-2-yl-N'-(selenophen-2-ylmethyl)ethane-1,2-diamine (CID 3024699) is N,N-dimethyl-N'-pyridin-2-yl-N'-(selenophen-2-ylmethyl)ethane-1,2-diamine.
What is the SMILES notation for N,N-dimethyl-N'-pyridin-2-yl-N'-(selenophen-2-ylmethyl)ethane-1,2-diamine?
The canonical SMILES for N,N-dimethyl-N'-pyridin-2-yl-N'-(selenophen-2-ylmethyl)ethane-1,2-diamine is CN(C)CCN(Cc1ccc[se]1)c1ccccn1.
What is the InChIKey of N,N-dimethyl-N'-pyridin-2-yl-N'-(selenophen-2-ylmethyl)ethane-1,2-diamine?
The InChIKey is MRHSQARURHMPOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3Se/c1-16(2)9-10-17(12-13-6-5-11-18-13)14-7-3-4-8-15-14/h3-8,11H,9-10,12H2,1-2H3.
What are the key properties of N,N-dimethyl-N'-pyridin-2-yl-N'-(selenophen-2-ylmethyl)ethane-1,2-diamine?
N,N-dimethyl-N'-pyridin-2-yl-N'-(selenophen-2-ylmethyl)ethane-1,2-diamine has a molecular weight of 308.29 g/mol, XLogP of 1.71, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-N'-pyridin-2-yl-N'-(selenophen-2-ylmethyl)ethane-1,2-diamine is sourced from PubChem (CID 3024699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).