C20H25N5S — CID 30247345
2-[[[4-(dimethylamino)phenyl]methyl-methylamino]methyl]-5-(4-methylphenyl)-1H-1,2,4-triazole-3-thione (PubChem CID 30247345) has the molecular formula C20H25N5S and a molecular weight of 367.52 g/mol. Its IUPAC name is 2-[[[4-(dimethylamino)phenyl]methyl-methylamino]methyl]-5-(4-methylphenyl)-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-[[[4-(dimethylamino)phenyl]methyl-methylamino]methyl]-5-(4-methylphenyl)-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 30247345 |
| Molecular Formula | C20H25N5S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 2-[[[4-(dimethylamino)phenyl]methyl-methylamino]methyl]-5-(4-methylphenyl)-1H-1,2,4-triazole-3-thione |
| SMILES | Cc1ccc(-c2nc(=S)n(CN(C)Cc3ccc(N(C)C)cc3)[nH]2)cc1 |
| InChI | InChI=1S/C20H25N5S/c1-15-5-9-17(10-6-15)19-21-20(26)25(22-19)14-24(4)13-16-7-11-18(12-8-16)23(2)3/h5-12H,13-14H2,1-4H3,(H,21,22,26) |
| InChIKey | ISEKZSKMYLZFMN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 40.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|