C25H28N2O4S2 — CID 30248258
2-(N-methylsulfonyl-4-phenylmethoxyanilino)-N-(3-phenylsulfanylpropyl)acetamide (PubChem CID 30248258) has the molecular formula C25H28N2O4S2 and a molecular weight of 484.64 g/mol. Its IUPAC name is 2-(N-methylsulfonyl-4-phenylmethoxyanilino)-N-(3-phenylsulfanylpropyl)acetamide.
| Compound Name | 2-(N-methylsulfonyl-4-phenylmethoxyanilino)-N-(3-phenylsulfanylpropyl)acetamide |
|---|---|
| PubChem CID | 30248258 |
| Molecular Formula | C25H28N2O4S2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 2-(N-methylsulfonyl-4-phenylmethoxyanilino)-N-(3-phenylsulfanylpropyl)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NCCCSc1ccccc1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H28N2O4S2/c1-33(29,30)27(19-25(28)26-17-8-18-32-24-11-6-3-7-12-24)22-13-15-23(16-14-22)31-20-21-9-4-2-5-10-21/h2-7,9-16H,8,17-20H2,1H3,(H,26,28) |
| InChIKey | MTUYXSSXWKNUMY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|