About 1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazine;hydrochloride
1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazine;hydrochloride (PubChem CID 3024952) has the molecular formula C12H13ClF6N2O2S
and a molecular weight of 398.76 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazine;hydrochloride.
Molecular Properties
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazine;hydrochloride |
| PubChem CID | 3024952 |
| Molecular Formula | C12H13ClF6N2O2S |
| Molecular Weight | 398.76 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazine;hydrochloride |
| SMILES | Cl.O=S(=O)(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCNCC1 |
| InChI | InChI=1S/C12H12F6N2O2S.ClH/c13-11(14,15)8-5-9(12(16,17)18)7-10(6-8)23(21,22)20-3-1-19-2-4-20;/h5-7,19H,1-4H2;1H |
| InChIKey | LREFTIFOIBSXDQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.76 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazine;hydrochloride?
The IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazine;hydrochloride (CID 3024952) is 1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazine;hydrochloride.
What is the SMILES notation for 1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazine;hydrochloride?
The canonical SMILES for 1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazine;hydrochloride is Cl.O=S(=O)(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCNCC1.
What is the InChIKey of 1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazine;hydrochloride?
The InChIKey is LREFTIFOIBSXDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F6N2O2S.ClH/c13-11(14,15)8-5-9(12(16,17)18)7-10(6-8)23(21,22)20-3-1-19-2-4-20;/h5-7,19H,1-4H2;1H.
What are the key properties of 1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazine;hydrochloride?
1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazine;hydrochloride has a molecular weight of 398.76 g/mol, XLogP of 2.74, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazine;hydrochloride is sourced from PubChem (CID 3024952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).