C15H24ClNO — CID 3024961
4-tert-butyl-2-(4-methylphenyl)morpholine;hydrochloride (PubChem CID 3024961) has the molecular formula C15H24ClNO and a molecular weight of 269.82 g/mol. Its IUPAC name is 4-tert-butyl-2-(4-methylphenyl)morpholine;hydrochloride.
| Compound Name | 4-tert-butyl-2-(4-methylphenyl)morpholine;hydrochloride |
|---|---|
| PubChem CID | 3024961 |
| Molecular Formula | C15H24ClNO |
| Molecular Weight | 269.82 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 4-tert-butyl-2-(4-methylphenyl)morpholine;hydrochloride |
| SMILES | Cc1ccc(C2CN(C(C)(C)C)CCO2)cc1.Cl |
| InChI | InChI=1S/C15H23NO.ClH/c1-12-5-7-13(8-6-12)14-11-16(9-10-17-14)15(2,3)4;/h5-8,14H,9-11H2,1-4H3;1H |
| InChIKey | HOEXSWKCMPEQMP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.82 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |