About 3-benzhydryloxy-1-benzylpyrrolidine;perchloric acid
3-benzhydryloxy-1-benzylpyrrolidine;perchloric acid (PubChem CID 3025249) has the molecular formula C24H26ClNO5
and a molecular weight of 443.93 g/mol. Its IUPAC name is 3-benzhydryloxy-1-benzylpyrrolidine;perchloric acid.
Molecular Properties
| Compound Name | 3-benzhydryloxy-1-benzylpyrrolidine;perchloric acid |
| PubChem CID | 3025249 |
| Molecular Formula | C24H26ClNO5 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 3-benzhydryloxy-1-benzylpyrrolidine;perchloric acid |
| SMILES | [O-][Cl+3]([O-])([O-])O.c1ccc(CN2CCC(OC(c3ccccc3)c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C24H25NO.ClHO4/c1-4-10-20(11-5-1)18-25-17-16-23(19-25)26-24(21-12-6-2-7-13-21)22-14-8-3-9-15-22;2-1(3,4)5/h1-15,23-24H,16-19H2;(H,2,3,4,5) |
| InChIKey | OWPWNDROJQEZTI-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-benzhydryloxy-1-benzylpyrrolidine;perchloric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzhydryloxy-1-benzylpyrrolidine;perchloric acid?
The IUPAC name of 3-benzhydryloxy-1-benzylpyrrolidine;perchloric acid (CID 3025249) is 3-benzhydryloxy-1-benzylpyrrolidine;perchloric acid.
What is the SMILES notation for 3-benzhydryloxy-1-benzylpyrrolidine;perchloric acid?
The canonical SMILES for 3-benzhydryloxy-1-benzylpyrrolidine;perchloric acid is [O-][Cl+3]([O-])([O-])O.c1ccc(CN2CCC(OC(c3ccccc3)c3ccccc3)C2)cc1.
What is the InChIKey of 3-benzhydryloxy-1-benzylpyrrolidine;perchloric acid?
The InChIKey is OWPWNDROJQEZTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25NO.ClHO4/c1-4-10-20(11-5-1)18-25-17-16-23(19-25)26-24(21-12-6-2-7-13-21)22-14-8-3-9-15-22;2-1(3,4)5/h1-15,23-24H,16-19H2;(H,2,3,4,5).
What are the key properties of 3-benzhydryloxy-1-benzylpyrrolidine;perchloric acid?
3-benzhydryloxy-1-benzylpyrrolidine;perchloric acid has a molecular weight of 443.93 g/mol, XLogP of 0.94, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzhydryloxy-1-benzylpyrrolidine;perchloric acid is sourced from PubChem (CID 3025249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).